C17H20N2O — CID 46197708
(2R,3S)-2-methylspiro[1,2,4,9-tetrahydrocarbazole-3,3'-piperidine]-2'-one (PubChem CID 46197708) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (2R,3S)-2-methylspiro[1,2,4,9-tetrahydrocarbazole-3,3'-piperidine]-2'-one.
| Compound Name | (2R,3S)-2-methylspiro[1,2,4,9-tetrahydrocarbazole-3,3'-piperidine]-2'-one |
|---|---|
| PubChem CID | 46197708 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (2R,3S)-2-methylspiro[1,2,4,9-tetrahydrocarbazole-3,3'-piperidine]-2'-one |
| SMILES | C[C@@H]1Cc2[nH]c3ccccc3c2C[C@@]12CCCNC2=O |
| InChI | InChI=1S/C17H20N2O/c1-11-9-15-13(12-5-2-3-6-14(12)19-15)10-17(11)7-4-8-18-16(17)20/h2-3,5-6,11,19H,4,7-10H2,1H3,(H,18,20)/t11-,17+/m1/s1 |
| InChIKey | UFRJWYSGNKJQHN-DIFFPNOSSA-N |
| XLogP | 2.80 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|