C15H18N2O — CID 132516896
(3aS,10aR)-3a-methoxy-2,3,4,9,10,10a-hexahydro-1H-pyrrolo[2,3-b]carbazole (PubChem CID 132516896) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is (3aS,10aR)-3a-methoxy-2,3,4,9,10,10a-hexahydro-1H-pyrrolo[2,3-b]carbazole.
| Compound Name | (3aS,10aR)-3a-methoxy-2,3,4,9,10,10a-hexahydro-1H-pyrrolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 132516896 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (3aS,10aR)-3a-methoxy-2,3,4,9,10,10a-hexahydro-1H-pyrrolo[2,3-b]carbazole |
| SMILES | CO[C@@]12CCN[C@@H]1Cc1[nH]c3ccccc3c1C2 |
| InChI | InChI=1S/C15H18N2O/c1-18-15-6-7-16-14(15)8-13-11(9-15)10-4-2-3-5-12(10)17-13/h2-5,14,16-17H,6-9H2,1H3/t14-,15-/m1/s1 |
| InChIKey | GZZICZZKEAZLMT-HUUCEWRRSA-N |
| XLogP | 2.01 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|