C16H17ClN2 — CID 139066884
3-[(2S,3R)-3-chloro-3-methyl-1,2,4,9-tetrahydrocarbazol-2-yl]propanenitrile (PubChem CID 139066884) has the molecular formula C16H17ClN2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 3-[(2S,3R)-3-chloro-3-methyl-1,2,4,9-tetrahydrocarbazol-2-yl]propanenitrile.
| Compound Name | 3-[(2S,3R)-3-chloro-3-methyl-1,2,4,9-tetrahydrocarbazol-2-yl]propanenitrile |
|---|---|
| PubChem CID | 139066884 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-[(2S,3R)-3-chloro-3-methyl-1,2,4,9-tetrahydrocarbazol-2-yl]propanenitrile |
| SMILES | C[C@@]1(Cl)Cc2c([nH]c3ccccc23)C[C@@H]1CCC#N |
| InChI | InChI=1S/C16H17ClN2/c1-16(17)10-13-12-6-2-3-7-14(12)19-15(13)9-11(16)5-4-8-18/h2-3,6-7,11,19H,4-5,9-10H2,1H3/t11-,16+/m0/s1 |
| InChIKey | HAMWOROVWBXNMI-MEDUHNTESA-N |
| XLogP | 4.18 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|