C15H16N2O3 — CID 91386996
(3-acetamido-1,2,4,9-tetrahydrocarbazol-3-yl) formate (PubChem CID 91386996) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3-acetamido-1,2,4,9-tetrahydrocarbazol-3-yl) formate.
| Compound Name | (3-acetamido-1,2,4,9-tetrahydrocarbazol-3-yl) formate |
|---|---|
| PubChem CID | 91386996 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (3-acetamido-1,2,4,9-tetrahydrocarbazol-3-yl) formate |
| SMILES | CC(=O)NC1(OC=O)CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C15H16N2O3/c1-10(19)17-15(20-9-18)7-6-14-12(8-15)11-4-2-3-5-13(11)16-14/h2-5,9,16H,6-8H2,1H3,(H,17,19) |
| InChIKey | ODHSALAKABTSEC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|