C13H14N2O2 — CID 91339726
(3-amino-1,2,4,9-tetrahydrocarbazol-3-yl) formate (PubChem CID 91339726) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is (3-amino-1,2,4,9-tetrahydrocarbazol-3-yl) formate.
| Compound Name | (3-amino-1,2,4,9-tetrahydrocarbazol-3-yl) formate |
|---|---|
| PubChem CID | 91339726 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (3-amino-1,2,4,9-tetrahydrocarbazol-3-yl) formate |
| SMILES | NC1(OC=O)CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C13H14N2O2/c14-13(17-8-16)6-5-12-10(7-13)9-3-1-2-4-11(9)15-12/h1-4,8,15H,5-7,14H2 |
| InChIKey | YUJNIJFVMLBCOM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|