C21H20N2O2 — CID 749910
(3S)-3-(3,4-dimethoxyphenyl)-1,2,4,9-tetrahydrocarbazole-3-carbonitrile (PubChem CID 749910) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (3S)-3-(3,4-dimethoxyphenyl)-1,2,4,9-tetrahydrocarbazole-3-carbonitrile.
| Compound Name | (3S)-3-(3,4-dimethoxyphenyl)-1,2,4,9-tetrahydrocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 749910 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (3S)-3-(3,4-dimethoxyphenyl)-1,2,4,9-tetrahydrocarbazole-3-carbonitrile |
| SMILES | COc1ccc([C@]2(C#N)CCc3[nH]c4ccccc4c3C2)cc1OC |
| InChI | InChI=1S/C21H20N2O2/c1-24-19-8-7-14(11-20(19)25-2)21(13-22)10-9-18-16(12-21)15-5-3-4-6-17(15)23-18/h3-8,11,23H,9-10,12H2,1-2H3/t21-/m1/s1 |
| InChIKey | KQYRDYGVRCCLNT-OAQYLSRUSA-N |
| XLogP | 4.14 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|