C22H27NO4 — CID 152635732
methyl 4-cyano-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylcyclohexene-1-carboxylate (PubChem CID 152635732) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is methyl 4-cyano-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylcyclohexene-1-carboxylate.
| Compound Name | methyl 4-cyano-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 152635732 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | methyl 4-cyano-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylcyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)CC(C#N)(c2ccc(OC)c(OC3CCCC3)c2)CC1 |
| InChI | InChI=1S/C22H27NO4/c1-15-13-22(14-23,11-10-18(15)21(24)26-3)16-8-9-19(25-2)20(12-16)27-17-6-4-5-7-17/h8-9,12,17H,4-7,10-11,13H2,1-3H3 |
| InChIKey | ZEMLYKVZSUREGG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |