C21H28N2O4 — CID 56978038
methyl 1-amino-3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexane-1-carboxylate (PubChem CID 56978038) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is methyl 1-amino-3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexane-1-carboxylate.
| Compound Name | methyl 1-amino-3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 56978038 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | methyl 1-amino-3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCCC(C#N)(c2ccc(OC)c(OC3CCCC3)c2)C1 |
| InChI | InChI=1S/C21H28N2O4/c1-25-17-9-8-15(12-18(17)27-16-6-3-4-7-16)20(14-22)10-5-11-21(23,13-20)19(24)26-2/h8-9,12,16H,3-7,10-11,13,23H2,1-2H3 |
| InChIKey | OSXGRPVWVPMFQV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |