C21H29N3O4 — CID 10200231
(2S)-2-[4-cyano-4-(3-cyclopentyloxy-4-methoxyphenyl)piperidin-1-yl]-N-hydroxypropanamide (PubChem CID 10200231) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is (2S)-2-[4-cyano-4-(3-cyclopentyloxy-4-methoxyphenyl)piperidin-1-yl]-N-hydroxypropanamide.
| Compound Name | (2S)-2-[4-cyano-4-(3-cyclopentyloxy-4-methoxyphenyl)piperidin-1-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 10200231 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (2S)-2-[4-cyano-4-(3-cyclopentyloxy-4-methoxyphenyl)piperidin-1-yl]-N-hydroxypropanamide |
| SMILES | COc1ccc(C2(C#N)CCN([C@@H](C)C(=O)NO)CC2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H29N3O4/c1-15(20(25)23-26)24-11-9-21(14-22,10-12-24)16-7-8-18(27-2)19(13-16)28-17-5-3-4-6-17/h7-8,13,15,17,26H,3-6,9-12H2,1-2H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | NSYYFQMQNAQQGB-HNNXBMFYSA-N |
| XLogP | 2.77 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|