C21H25NO4 — CID 73081210
5-cyano-5-(3-cyclobutyloxy-4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid (PubChem CID 73081210) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 5-cyano-5-(3-cyclobutyloxy-4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid.
| Compound Name | 5-cyano-5-(3-cyclobutyloxy-4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
|---|---|
| PubChem CID | 73081210 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 5-cyano-5-(3-cyclobutyloxy-4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
| SMILES | COc1ccc(C2(C#N)CC3CC(C(=O)O)CC3C2)cc1OC1CCC1 |
| InChI | InChI=1S/C21H25NO4/c1-25-18-6-5-16(9-19(18)26-17-3-2-4-17)21(12-22)10-14-7-13(20(23)24)8-15(14)11-21/h5-6,9,13-15,17H,2-4,7-8,10-11H2,1H3,(H,23,24) |
| InChIKey | BFSLGRJSNMKENL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |