C22H27NO4 — CID 11210884
cis-(3S,4R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3,4-bis(2-oxoethyl)cyclopentane-1-carbonitrile (PubChem CID 11210884) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is cis-(3S,4R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3,4-bis(2-oxoethyl)cyclopentane-1-carbonitrile.
| Compound Name | cis-(3S,4R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3,4-bis(2-oxoethyl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 11210884 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | cis-(3S,4R)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3,4-bis(2-oxoethyl)cyclopentane-1-carbonitrile |
| SMILES | COc1ccc(C2(C#N)C[C@@H](CC=O)[C@@H](CC=O)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C22H27NO4/c1-26-20-7-6-18(12-21(20)27-19-4-2-3-5-19)22(15-23)13-16(8-10-24)17(14-22)9-11-25/h6-7,10-12,16-17,19H,2-5,8-9,13-14H2,1H3/t16-,17+,22? |
| InChIKey | BSWNSEYJJIZSRS-AQKKSAQBSA-N |
| XLogP | 3.98 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|