C21H28N2O3 — CID 18663795
N-[(1R,3S)-3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexyl]acetamide (PubChem CID 18663795) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(1R,3S)-3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexyl]acetamide.
| Compound Name | N-[(1R,3S)-3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 18663795 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-[(1R,3S)-3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexyl]acetamide |
| SMILES | COc1ccc([C@]2(C#N)CCC[C@@H](NC(C)=O)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H28N2O3/c1-15(24)23-17-6-5-11-21(13-17,14-22)16-9-10-19(25-2)20(12-16)26-18-7-3-4-8-18/h9-10,12,17-18H,3-8,11,13H2,1-2H3,(H,23,24)/t17-,21-/m1/s1 |
| InChIKey | KJQANBHHCYLQKO-DYESRHJHSA-N |
| XLogP | 3.86 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |