C22H30N2O4 — CID 23223660
methyl N-[3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexyl]-N-methylcarbamate (PubChem CID 23223660) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is methyl N-[3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexyl]-N-methylcarbamate.
| Compound Name | methyl N-[3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 23223660 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | methyl N-[3-cyano-3-(3-cyclopentyloxy-4-methoxyphenyl)cyclohexyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)C1CCCC(C#N)(c2ccc(OC)c(OC3CCCC3)c2)C1 |
| InChI | InChI=1S/C22H30N2O4/c1-24(21(25)27-3)17-7-6-12-22(14-17,15-23)16-10-11-19(26-2)20(13-16)28-18-8-4-5-9-18/h10-11,13,17-18H,4-9,12,14H2,1-3H3 |
| InChIKey | SMTKMFQVLSMRCF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |