C22H29NO4S — CID 72752776
5-cyano-5-[4-methoxy-3-(4-methylsulfanylbutoxy)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid (PubChem CID 72752776) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is 5-cyano-5-[4-methoxy-3-(4-methylsulfanylbutoxy)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid.
| Compound Name | 5-cyano-5-[4-methoxy-3-(4-methylsulfanylbutoxy)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
|---|---|
| PubChem CID | 72752776 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 5-cyano-5-[4-methoxy-3-(4-methylsulfanylbutoxy)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
| SMILES | COc1ccc(C2(C#N)CC3CC(C(=O)O)CC3C2)cc1OCCCCSC |
| InChI | InChI=1S/C22H29NO4S/c1-26-19-6-5-18(11-20(19)27-7-3-4-8-28-2)22(14-23)12-16-9-15(21(24)25)10-17(16)13-22/h5-6,11,15-17H,3-4,7-10,12-13H2,1-2H3,(H,24,25) |
| InChIKey | MHJLGRAWPQYTHF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|