C24H22F3NO5S — CID 11260419
[(3aR,5R,6aR)-5-cyano-5-(4-methoxy-3-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl] trifluoromethanesulfonate (PubChem CID 11260419) has the molecular formula C24H22F3NO5S and a molecular weight of 493.50 g/mol. Its IUPAC name is [(3aR,5R,6aR)-5-cyano-5-(4-methoxy-3-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,5R,6aR)-5-cyano-5-(4-methoxy-3-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11260419 |
| Molecular Formula | C24H22F3NO5S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [(3aR,5R,6aR)-5-cyano-5-(4-methoxy-3-phenylmethoxyphenyl)-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc([C@@]2(C#N)C[C@@H]3CC(OS(=O)(=O)C(F)(F)F)=C[C@@H]3C2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22F3NO5S/c1-31-21-8-7-19(11-22(21)32-14-16-5-3-2-4-6-16)23(15-28)12-17-9-20(10-18(17)13-23)33-34(29,30)24(25,26)27/h2-9,11,17-18H,10,12-14H2,1H3/t17-,18+,23-/m1/s1 |
| InChIKey | OLLNSOXSURDFTD-IEGUWTFLSA-N |
| XLogP | 5.22 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|