C16H13F3O3 — CID 83951245
2,2,2-trifluoro-1-(4-methoxy-3-phenylmethoxyphenyl)ethanone (PubChem CID 83951245) has the molecular formula C16H13F3O3 and a molecular weight of 310.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-methoxy-3-phenylmethoxyphenyl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4-methoxy-3-phenylmethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 83951245 |
| Molecular Formula | C16H13F3O3 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-methoxy-3-phenylmethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)C(F)(F)F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C16H13F3O3/c1-21-13-8-7-12(15(20)16(17,18)19)9-14(13)22-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
| InChIKey | CPYRXFYUFILMDR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |