C20H24O3 — CID 19049285
1-(4-methoxy-3-phenylmethoxyphenyl)-4-methylpentan-1-one (PubChem CID 19049285) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(4-methoxy-3-phenylmethoxyphenyl)-4-methylpentan-1-one.
| Compound Name | 1-(4-methoxy-3-phenylmethoxyphenyl)-4-methylpentan-1-one |
|---|---|
| PubChem CID | 19049285 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(4-methoxy-3-phenylmethoxyphenyl)-4-methylpentan-1-one |
| SMILES | COc1ccc(C(=O)CCC(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H24O3/c1-15(2)9-11-18(21)17-10-12-19(22-3)20(13-17)23-14-16-7-5-4-6-8-16/h4-8,10,12-13,15H,9,11,14H2,1-3H3 |
| InChIKey | FRIQJUCURAANQS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |