C18H21NO4 — CID 85432081
5-cyano-5-(3,4-dimethoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid (PubChem CID 85432081) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-cyano-5-(3,4-dimethoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid.
| Compound Name | 5-cyano-5-(3,4-dimethoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
|---|---|
| PubChem CID | 85432081 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 5-cyano-5-(3,4-dimethoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
| SMILES | COc1ccc(C2(C#N)CC3CC(C(=O)O)CC3C2)cc1OC |
| InChI | InChI=1S/C18H21NO4/c1-22-15-4-3-14(7-16(15)23-2)18(10-19)8-12-5-11(17(20)21)6-13(12)9-18/h3-4,7,11-13H,5-6,8-9H2,1-2H3,(H,20,21) |
| InChIKey | BHEOYIGPFQUZIV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |