C17H19F2NO4 — CID 70085888
methyl 3-cyano-3-[3-(difluoromethoxy)-4-methoxyphenyl]cyclohexane-1-carboxylate (PubChem CID 70085888) has the molecular formula C17H19F2NO4 and a molecular weight of 339.34 g/mol. Its IUPAC name is methyl 3-cyano-3-[3-(difluoromethoxy)-4-methoxyphenyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 3-cyano-3-[3-(difluoromethoxy)-4-methoxyphenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70085888 |
| Molecular Formula | C17H19F2NO4 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl 3-cyano-3-[3-(difluoromethoxy)-4-methoxyphenyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCC(C#N)(c2ccc(OC)c(OC(F)F)c2)C1 |
| InChI | InChI=1S/C17H19F2NO4/c1-22-13-6-5-12(8-14(13)24-16(18)19)17(10-20)7-3-4-11(9-17)15(21)23-2/h5-6,8,11,16H,3-4,7,9H2,1-2H3 |
| InChIKey | HLIXBTZJUKVNLZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |