C16H18N2O3 — CID 3757105
1-(3,4-dimethoxyphenyl)-4-hydroxycyclohexane-1,4-dicarbonitrile (PubChem CID 3757105) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-hydroxycyclohexane-1,4-dicarbonitrile.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-hydroxycyclohexane-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 3757105 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-hydroxycyclohexane-1,4-dicarbonitrile |
| SMILES | COc1ccc(C2(C#N)CCC(O)(C#N)CC2)cc1OC |
| InChI | InChI=1S/C16H18N2O3/c1-20-13-4-3-12(9-14(13)21-2)15(10-17)5-7-16(19,11-18)8-6-15/h3-4,9,19H,5-8H2,1-2H3 |
| InChIKey | ITAZKJGLJISRSM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|