C24H25NO2 — CID 11739873
(3aS,7aR)-2-(4-methoxy-3-phenylmethoxyphenyl)-1,3,3a,4,7,7a-hexahydroindene-2-carbonitrile (PubChem CID 11739873) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3aS,7aR)-2-(4-methoxy-3-phenylmethoxyphenyl)-1,3,3a,4,7,7a-hexahydroindene-2-carbonitrile.
| Compound Name | (3aS,7aR)-2-(4-methoxy-3-phenylmethoxyphenyl)-1,3,3a,4,7,7a-hexahydroindene-2-carbonitrile |
|---|---|
| PubChem CID | 11739873 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (3aS,7aR)-2-(4-methoxy-3-phenylmethoxyphenyl)-1,3,3a,4,7,7a-hexahydroindene-2-carbonitrile |
| SMILES | COc1ccc(C2(C#N)C[C@H]3CC=CC[C@H]3C2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H25NO2/c1-26-22-12-11-21(13-23(22)27-16-18-7-3-2-4-8-18)24(17-25)14-19-9-5-6-10-20(19)15-24/h2-8,11-13,19-20H,9-10,14-16H2,1H3/t19-,20+,24? |
| InChIKey | KRZWVGUHZFOAFU-VXMMSVGHSA-N |
| XLogP | 5.41 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|