C22H24N2O3 — CID 84581794
2-(3,4-dimethoxyphenyl)-1-(2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-3-yl)ethanone (PubChem CID 84581794) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-(2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-3-yl)ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-(2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-3-yl)ethanone |
|---|---|
| PubChem CID | 84581794 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-(2,4,5,6-tetrahydro-1H-azepino[4,5-b]indol-3-yl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCc3[nH]c4ccccc4c3CC2)cc1OC |
| InChI | InChI=1S/C22H24N2O3/c1-26-20-8-7-15(13-21(20)27-2)14-22(25)24-11-9-17-16-5-3-4-6-18(16)23-19(17)10-12-24/h3-8,13,23H,9-12,14H2,1-2H3 |
| InChIKey | DFZJYMWBJQEKGD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|