C28H24N2O4 — CID 90925574
[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2,4,9-tetrahydrocarbazol-3-yl] formate (PubChem CID 90925574) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is [(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2,4,9-tetrahydrocarbazol-3-yl] formate.
| Compound Name | [(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2,4,9-tetrahydrocarbazol-3-yl] formate |
|---|---|
| PubChem CID | 90925574 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2,4,9-tetrahydrocarbazol-3-yl] formate |
| SMILES | O=CO[C@@]1(NC(=O)OCC2c3ccccc3-c3ccccc32)CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C28H24N2O4/c31-17-34-28(14-13-26-23(15-28)22-11-5-6-12-25(22)29-26)30-27(32)33-16-24-20-9-3-1-7-18(20)19-8-2-4-10-21(19)24/h1-12,17,24,29H,13-16H2,(H,30,32)/t28-/m0/s1 |
| InChIKey | VEYWOMJKLRTVHG-NDEPHWFRSA-N |
| XLogP | 5.06 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|