C24H27NO4 — CID 135186585
[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclooctyl] formate (PubChem CID 135186585) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is [1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclooctyl] formate.
| Compound Name | [1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclooctyl] formate |
|---|---|
| PubChem CID | 135186585 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclooctyl] formate |
| SMILES | O=COC1(NC(=O)OCC2c3ccccc3-c3ccccc32)CCCCCCC1 |
| InChI | InChI=1S/C24H27NO4/c26-17-29-24(14-8-2-1-3-9-15-24)25-23(27)28-16-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h4-7,10-13,17,22H,1-3,8-9,14-16H2,(H,25,27) |
| InChIKey | KXIJYBMTNCGSLV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|