C26H33NO5 — CID 159560192
cis-prop-2-enyl (1R,2R)-1-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxycyclopentane-1-carboxylate;methane (PubChem CID 159560192) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is cis-prop-2-enyl (1R,2R)-1-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxycyclopentane-1-carboxylate;methane.
| Compound Name | cis-prop-2-enyl (1R,2R)-1-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxycyclopentane-1-carboxylate;methane |
|---|---|
| PubChem CID | 159560192 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | cis-prop-2-enyl (1R,2R)-1-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxycyclopentane-1-carboxylate;methane |
| SMILES | C.C.C=CCOC(=O)[C@@]1(NC(=O)OCC2c3ccccc3-c3ccccc32)CCC[C@H]1O |
| InChI | InChI=1S/C24H25NO5.2CH4/c1-2-14-29-22(27)24(13-7-12-21(24)26)25-23(28)30-15-20-18-10-5-3-8-16(18)17-9-4-6-11-19(17)20;;/h2-6,8-11,20-21,26H,1,7,12-15H2,(H,25,28);2*1H4/t21-,24-;;/m1../s1 |
| InChIKey | MGMVEZVHADSJAJ-YONVIXBVSA-N |
| XLogP | 4.81 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|