C23H23NO5 — CID 69050064
1-O-(9H-fluoren-9-ylmethyl) 2-O-prop-2-enyl 3-hydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 69050064) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-O-(9H-fluoren-9-ylmethyl) 2-O-prop-2-enyl 3-hydroxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-(9H-fluoren-9-ylmethyl) 2-O-prop-2-enyl 3-hydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69050064 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-O-(9H-fluoren-9-ylmethyl) 2-O-prop-2-enyl 3-hydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)C1C(O)CCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H23NO5/c1-2-13-28-22(26)21-20(25)11-12-24(21)23(27)29-14-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h2-10,19-21,25H,1,11-14H2 |
| InChIKey | KGHKKXPMQAIVJO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|