C21H20INO4 — CID 175014630
1-O-(9H-fluoren-9-ylmethyl) 3-O-prop-2-enyl 2-amino-2-(iodomethyl)propanedioate (PubChem CID 175014630) has the molecular formula C21H20INO4 and a molecular weight of 477.30 g/mol. Its IUPAC name is 1-O-(9H-fluoren-9-ylmethyl) 3-O-prop-2-enyl 2-amino-2-(iodomethyl)propanedioate.
| Compound Name | 1-O-(9H-fluoren-9-ylmethyl) 3-O-prop-2-enyl 2-amino-2-(iodomethyl)propanedioate |
|---|---|
| PubChem CID | 175014630 |
| Molecular Formula | C21H20INO4 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 1-O-(9H-fluoren-9-ylmethyl) 3-O-prop-2-enyl 2-amino-2-(iodomethyl)propanedioate |
| SMILES | C=CCOC(=O)C(N)(CI)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H20INO4/c1-2-11-26-19(24)21(23,13-22)20(25)27-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-10,18H,1,11-13,23H2 |
| InChIKey | IJMYUFLBMXZDFB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|