About 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate
4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate (PubChem CID 6612799) has the molecular formula C34H28O6
and a molecular weight of 532.59 g/mol. Its IUPAC name is 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate.
Molecular Properties
| Compound Name | 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate |
| PubChem CID | 6612799 |
| Molecular Formula | C34H28O6 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate |
| SMILES | O=C(OCC=CCOC(=O)OCC1c2ccccc2-c2ccccc21)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H28O6/c35-33(39-21-31-27-15-5-1-11-23(27)24-12-2-6-16-28(24)31)37-19-9-10-20-38-34(36)40-22-32-29-17-7-3-13-25(29)26-14-4-8-18-30(26)32/h1-18,31-32H,19-22H2 |
| InChIKey | YDWCEQFMNWVFAM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate?
The IUPAC name of 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate (CID 6612799) is 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate.
What is the SMILES notation for 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate?
The canonical SMILES for 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate is O=C(OCC=CCOC(=O)OCC1c2ccccc2-c2ccccc21)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate?
The InChIKey is YDWCEQFMNWVFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H28O6/c35-33(39-21-31-27-15-5-1-11-23(27)24-12-2-6-16-28(24)31)37-19-9-10-20-38-34(36)40-22-32-29-17-7-3-13-25(29)26-14-4-8-18-30(26)32/h1-18,31-32H,19-22H2.
What are the key properties of 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate?
4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate has a molecular weight of 532.59 g/mol, XLogP of 7.47, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(9H-fluoren-9-ylmethoxycarbonyloxy)but-2-enyl 9H-fluoren-9-ylmethyl carbonate is sourced from PubChem (CID 6612799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).