C28H30N2O6 — CID 169024984
9H-fluoren-9-ylmethyl (4S)-5-oxo-4-[(1-prop-2-enoxycarbonylpiperidin-4-yl)methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 169024984) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (4S)-5-oxo-4-[(1-prop-2-enoxycarbonylpiperidin-4-yl)methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (4S)-5-oxo-4-[(1-prop-2-enoxycarbonylpiperidin-4-yl)methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 169024984 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (4S)-5-oxo-4-[(1-prop-2-enoxycarbonylpiperidin-4-yl)methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCOC(=O)N1CCC(C[C@H]2C(=O)OCN2C(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C28H30N2O6/c1-2-15-34-27(32)29-13-11-19(12-14-29)16-25-26(31)36-18-30(25)28(33)35-17-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h2-10,19,24-25H,1,11-18H2/t25-/m0/s1 |
| InChIKey | WOXWEFZDWQSVPQ-VWLOTQADSA-N |
| XLogP | 4.55 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|