C20H16N2O4 — CID 25189352
9H-fluoren-9-ylmethyl (4S)-4-(isocyanomethyl)-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 25189352) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (4S)-4-(isocyanomethyl)-5-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (4S)-4-(isocyanomethyl)-5-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 25189352 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (4S)-4-(isocyanomethyl)-5-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | [C-]#[N+]C[C@H]1C(=O)OCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H16N2O4/c1-21-10-18-19(23)26-12-22(18)20(24)25-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-18H,10-12H2/t18-/m0/s1 |
| InChIKey | PRCKCDWEEJRQOB-SFHVURJKSA-N |
| XLogP | 3.04 |
| TPSA | 60.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|