C21H24N2O2 — CID 7145106
9H-fluoren-9-ylmethyl (2R)-2-(aminomethyl)piperidine-1-carboxylate (PubChem CID 7145106) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2R)-2-(aminomethyl)piperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2R)-2-(aminomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 7145106 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2R)-2-(aminomethyl)piperidine-1-carboxylate |
| SMILES | NC[C@H]1CCCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H24N2O2/c22-13-15-7-5-6-12-23(15)21(24)25-14-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-4,8-11,15,20H,5-7,12-14,22H2/t15-/m1/s1 |
| InChIKey | ITGBZJASSQWWSB-OAHLLOKOSA-N |
| XLogP | 3.75 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |