C39H33NO3 — CID 175704806
9H-fluoren-9-ylmethyl (2S)-2-(2,2,2-triphenylacetyl)pyrrolidine-1-carboxylate (PubChem CID 175704806) has the molecular formula C39H33NO3 and a molecular weight of 563.70 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S)-2-(2,2,2-triphenylacetyl)pyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S)-2-(2,2,2-triphenylacetyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175704806 |
| Molecular Formula | C39H33NO3 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S)-2-(2,2,2-triphenylacetyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1CCC[C@H]1C(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H33NO3/c41-37(39(28-15-4-1-5-16-28,29-17-6-2-7-18-29)30-19-8-3-9-20-30)36-25-14-26-40(36)38(42)43-27-35-33-23-12-10-21-31(33)32-22-11-13-24-34(32)35/h1-13,15-24,35-36H,14,25-27H2/t36-/m0/s1 |
| InChIKey | FXQWIMQOOHFLBD-BHVANESWSA-N |
| XLogP | 8.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|