C25H26Cl2N2O4 — CID 174709081
9H-fluoren-9-ylmethyl (2S)-2-carbonochloridoylpyrrolidine-1-carboxylate;(2S)-pyrrolidine-2-carbonyl chloride (PubChem CID 174709081) has the molecular formula C25H26Cl2N2O4 and a molecular weight of 489.40 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S)-2-carbonochloridoylpyrrolidine-1-carboxylate;(2S)-pyrrolidine-2-carbonyl chloride.
| Compound Name | 9H-fluoren-9-ylmethyl (2S)-2-carbonochloridoylpyrrolidine-1-carboxylate;(2S)-pyrrolidine-2-carbonyl chloride |
|---|---|
| PubChem CID | 174709081 |
| Molecular Formula | C25H26Cl2N2O4 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S)-2-carbonochloridoylpyrrolidine-1-carboxylate;(2S)-pyrrolidine-2-carbonyl chloride |
| SMILES | O=C(Cl)[C@@H]1CCCN1.O=C(Cl)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H18ClNO3.C5H8ClNO/c21-19(23)18-10-5-11-22(18)20(24)25-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17;6-5(8)4-2-1-3-7-4/h1-4,6-9,17-18H,5,10-12H2;4,7H,1-3H2/t18-;4-/m00/s1 |
| InChIKey | ZQYIEPAQQAEKSG-HCFWXMEPSA-N |
| XLogP | 4.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|