C27H23NO4Se — CID 140685279
9H-fluoren-9-ylmethyl (2R)-2-(2-formylphenyl)selanylcarbonylpyrrolidine-1-carboxylate (PubChem CID 140685279) has the molecular formula C27H23NO4Se and a molecular weight of 504.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2R)-2-(2-formylphenyl)selanylcarbonylpyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2R)-2-(2-formylphenyl)selanylcarbonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140685279 |
| Molecular Formula | C27H23NO4Se |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2R)-2-(2-formylphenyl)selanylcarbonylpyrrolidine-1-carboxylate |
| SMILES | O=Cc1ccccc1[Se]C(=O)[C@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H23NO4Se/c29-16-18-8-1-6-14-25(18)33-26(30)24-13-7-15-28(24)27(31)32-17-23-21-11-4-2-9-19(21)20-10-3-5-12-22(20)23/h1-6,8-12,14,16,23-24H,7,13,15,17H2/t24-/m1/s1 |
| InChIKey | JFNMDEZBNLVCFW-XMMPIXPASA-N |
| XLogP | 3.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|