C27H22N2O6S — CID 101237843
9H-fluoren-9-ylmethyl (2S)-2-(2-formyl-4-nitrophenyl)sulfanylcarbonylpyrrolidine-1-carboxylate (PubChem CID 101237843) has the molecular formula C27H22N2O6S and a molecular weight of 502.55 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S)-2-(2-formyl-4-nitrophenyl)sulfanylcarbonylpyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S)-2-(2-formyl-4-nitrophenyl)sulfanylcarbonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101237843 |
| Molecular Formula | C27H22N2O6S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S)-2-(2-formyl-4-nitrophenyl)sulfanylcarbonylpyrrolidine-1-carboxylate |
| SMILES | O=Cc1cc([N+](=O)[O-])ccc1SC(=O)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H22N2O6S/c30-15-17-14-18(29(33)34)11-12-25(17)36-26(31)24-10-5-13-28(24)27(32)35-16-23-21-8-3-1-6-19(21)20-7-2-4-9-22(20)23/h1-4,6-9,11-12,14-15,23-24H,5,10,13,16H2/t24-/m0/s1 |
| InChIKey | CLCVYKSAXUIOAV-DEOSSOPVSA-N |
| XLogP | 5.44 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|