C22H22NO4- — CID 86295162
2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetate (PubChem CID 86295162) has the molecular formula C22H22NO4- and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetate.
| Compound Name | 2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 86295162 |
| Molecular Formula | C22H22NO4- |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetate |
| SMILES | O=C([O-])C[C@@H]1CCCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H23NO4/c24-21(25)13-15-7-5-6-12-23(15)22(26)27-14-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-4,8-11,15,20H,5-7,12-14H2,(H,24,25)/p-1/t15-/m0/s1 |
| InChIKey | YVHXTQQJFAOBCJ-HNNXBMFYSA-M |
| XLogP | 2.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |