C24H27NO4 — CID 72747808
9H-fluoren-9-ylmethyl 2-(2-acetyloxyethyl)piperidine-1-carboxylate (PubChem CID 72747808) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-(2-acetyloxyethyl)piperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-(2-acetyloxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 72747808 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-(2-acetyloxyethyl)piperidine-1-carboxylate |
| SMILES | CC(=O)OCCC1CCCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H27NO4/c1-17(26)28-15-13-18-8-6-7-14-25(18)24(27)29-16-23-21-11-4-2-9-19(21)20-10-3-5-12-22(20)23/h2-5,9-12,18,23H,6-8,13-16H2,1H3 |
| InChIKey | SROCIQBJVMGNTA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |