About 2-(9H-fluoren-9-yl)ethyl acetate
2-(9H-fluoren-9-yl)ethyl acetate (PubChem CID 134437630) has the molecular formula C17H16O2
and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(9H-fluoren-9-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(9H-fluoren-9-yl)ethyl acetate |
| PubChem CID | 134437630 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-(9H-fluoren-9-yl)ethyl acetate |
| SMILES | CC(=O)OCCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H16O2/c1-12(18)19-11-10-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17H,10-11H2,1H3 |
| InChIKey | GSTBRQWQGDNFEX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(9H-fluoren-9-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9H-fluoren-9-yl)ethyl acetate?
The IUPAC name of 2-(9H-fluoren-9-yl)ethyl acetate (CID 134437630) is 2-(9H-fluoren-9-yl)ethyl acetate.
What is the SMILES notation for 2-(9H-fluoren-9-yl)ethyl acetate?
The canonical SMILES for 2-(9H-fluoren-9-yl)ethyl acetate is CC(=O)OCCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 2-(9H-fluoren-9-yl)ethyl acetate?
The InChIKey is GSTBRQWQGDNFEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O2/c1-12(18)19-11-10-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17H,10-11H2,1H3.
What are the key properties of 2-(9H-fluoren-9-yl)ethyl acetate?
2-(9H-fluoren-9-yl)ethyl acetate has a molecular weight of 252.31 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9H-fluoren-9-yl)ethyl acetate is sourced from PubChem (CID 134437630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).