C18H17NO3 — CID 138478780
9H-fluoren-9-ylmethyl N-[(E)-1-hydroxyprop-1-en-2-yl]carbamate (PubChem CID 138478780) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(E)-1-hydroxyprop-1-en-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(E)-1-hydroxyprop-1-en-2-yl]carbamate |
|---|---|
| PubChem CID | 138478780 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(E)-1-hydroxyprop-1-en-2-yl]carbamate |
| SMILES | C/C(=C\O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H17NO3/c1-12(10-20)19-18(21)22-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-10,17,20H,11H2,1H3,(H,19,21)/b12-10+ |
| InChIKey | LBUIJWSFKQYBRD-ZRDIBKRKSA-N |
| XLogP | 3.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|