C22H24N2O2S — CID 134917791
9H-fluoren-9-ylmethyl N-(cyclohexylcarbamothioyl)carbamate (PubChem CID 134917791) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(cyclohexylcarbamothioyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(cyclohexylcarbamothioyl)carbamate |
|---|---|
| PubChem CID | 134917791 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(cyclohexylcarbamothioyl)carbamate |
| SMILES | O=C(NC(=S)NC1CCCCC1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H24N2O2S/c25-22(24-21(27)23-15-8-2-1-3-9-15)26-14-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)20/h4-7,10-13,15,20H,1-3,8-9,14H2,(H2,23,24,25,27) |
| InChIKey | XNWQHCHWQJSXGS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|