C25H28NO4- — CID 7176369
(3R)-4-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 7176369) has the molecular formula C25H28NO4- and a molecular weight of 406.50 g/mol. Its IUPAC name is (3R)-4-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | (3R)-4-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 7176369 |
| Molecular Formula | C25H28NO4- |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (3R)-4-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | O=C([O-])C[C@@H](CC1CCCCC1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H29NO4/c27-24(28)15-18(14-17-8-2-1-3-9-17)26-25(29)30-16-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h4-7,10-13,17-18,23H,1-3,8-9,14-16H2,(H,26,29)(H,27,28)/p-1/t18-/m1/s1 |
| InChIKey | RXBITLXZMVCYKD-GOSISDBHSA-M |
| XLogP | 4.00 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |