C25H21FNO4- — CID 7010392
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-fluorophenyl)butanoate (PubChem CID 7010392) has the molecular formula C25H21FNO4- and a molecular weight of 418.44 g/mol. Its IUPAC name is (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-fluorophenyl)butanoate.
| Compound Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-fluorophenyl)butanoate |
|---|---|
| PubChem CID | 7010392 |
| Molecular Formula | C25H21FNO4- |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-fluorophenyl)butanoate |
| SMILES | O=C([O-])C[C@H](Cc1cccc(F)c1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22FNO4/c26-17-7-5-6-16(12-17)13-18(14-24(28)29)27-25(30)31-15-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-12,18,23H,13-15H2,(H,27,30)(H,28,29)/p-1/t18-/m0/s1 |
| InChIKey | ZZCLRFMQVCVNGD-SFHVURJKSA-M |
| XLogP | 3.42 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |