C26H24FNO4 — CID 155889976
(PubChem CID 155889976) has the molecular formula C26H24FNO4 and a molecular weight of 433.48 g/mol.
| Compound Name | |
|---|---|
| PubChem CID | 155889976 |
| Molecular Formula | C26H24FNO4 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | — |
| SMILES | O=C(NC(CCCc1cccc(F)c1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H24FNO4/c27-18-9-5-7-17(15-18)8-6-14-24(25(29)30)28-26(31)32-16-23-21-12-3-1-10-19(21)20-11-2-4-13-22(20)23/h1-5,7,9-13,15,23-24H,6,8,14,16H2,(H,28,31)(H,29,30) |
| InChIKey | QEWGEYQPSUYSOD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |