C29H32N2O4 — CID 118936086
2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[methyl(2-phenylethyl)amino]pentanoic acid (PubChem CID 118936086) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[methyl(2-phenylethyl)amino]pentanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[methyl(2-phenylethyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 118936086 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[methyl(2-phenylethyl)amino]pentanoic acid |
| SMILES | CN(CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)CCc1ccccc1 |
| InChI | InChI=1S/C29H32N2O4/c1-31(19-17-21-10-3-2-4-11-21)18-9-16-27(28(32)33)30-29(34)35-20-26-24-14-7-5-12-22(24)23-13-6-8-15-25(23)26/h2-8,10-15,26-27H,9,16-20H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | BPXBTPHWWGKKTH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |