C27H28N2O4 — CID 11091521
9H-fluoren-9-ylmethyl N-[(2S)-4-[methoxy(methyl)amino]-4-oxo-1-phenylbutan-2-yl]carbamate (PubChem CID 11091521) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-4-[methoxy(methyl)amino]-4-oxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-[methoxy(methyl)amino]-4-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11091521 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-[methoxy(methyl)amino]-4-oxo-1-phenylbutan-2-yl]carbamate |
| SMILES | CON(C)C(=O)C[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H28N2O4/c1-29(32-2)26(30)17-20(16-19-10-4-3-5-11-19)28-27(31)33-18-25-23-14-8-6-12-21(23)22-13-7-9-15-24(22)25/h3-15,20,25H,16-18H2,1-2H3,(H,28,31)/t20-/m0/s1 |
| InChIKey | BLKNLDDMCAGKBR-FQEVSTJZSA-N |
| XLogP | 4.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|