C27H27NO4 — CID 118431285
(2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-5-phenylpentanoic acid (PubChem CID 118431285) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-5-phenylpentanoic acid.
| Compound Name | (2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 118431285 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-5-phenylpentanoic acid |
| SMILES | C[C@@H](C[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C27H27NO4/c1-18(26(29)30)15-20(16-19-9-3-2-4-10-19)28-27(31)32-17-25-23-13-7-5-11-21(23)22-12-6-8-14-24(22)25/h2-14,18,20,25H,15-17H2,1H3,(H,28,31)(H,29,30)/t18-,20+/m0/s1 |
| InChIKey | DVWXBTMXLQXLJE-AZUAARDMSA-N |
| XLogP | 5.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |