C26H29NO4 — CID 122539263
cyclopentyl (2R)-3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 122539263) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is cyclopentyl (2R)-3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | cyclopentyl (2R)-3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 122539263 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | cyclopentyl (2R)-3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | O=C(N[C@H](CC1CC1)C(=O)OC1CCCC1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H29NO4/c28-25(31-18-7-1-2-8-18)24(15-17-13-14-17)27-26(29)30-16-23-21-11-5-3-9-19(21)20-10-4-6-12-22(20)23/h3-6,9-12,17-18,23-24H,1-2,7-8,13-16H2,(H,27,29)/t24-/m1/s1 |
| InChIKey | UQGKSFZJQIYDKB-XMMPIXPASA-N |
| XLogP | 5.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |