C26H31NO6 — CID 131675536
acetic acid;3-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 131675536) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is acetic acid;3-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | acetic acid;3-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 131675536 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | acetic acid;3-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CC(=O)O.O=C(NC(CC1CCCCC1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H27NO4.C2H4O2/c26-23(27)22(14-16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21;1-2(3)4/h4-7,10-13,16,21-22H,1-3,8-9,14-15H2,(H,25,28)(H,26,27);1H3,(H,3,4) |
| InChIKey | YBNWFLCIYSQUNF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |