C28H29N3O3 — CID 45112398
9H-fluoren-9-ylmethyl N-[4-(cyclohexylcarbamoylamino)phenyl]carbamate (PubChem CID 45112398) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(cyclohexylcarbamoylamino)phenyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(cyclohexylcarbamoylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 45112398 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(cyclohexylcarbamoylamino)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C28H29N3O3/c32-27(29-19-8-2-1-3-9-19)30-20-14-16-21(17-15-20)31-28(33)34-18-26-24-12-6-4-10-22(24)23-11-5-7-13-25(23)26/h4-7,10-17,19,26H,1-3,8-9,18H2,(H,31,33)(H2,29,30,32) |
| InChIKey | GUFCBQNYBABMNO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |