C26H26N2O3 — CID 90337303
9H-fluoren-9-ylmethyl N-[4-(tert-butylcarbamoyl)phenyl]carbamate (PubChem CID 90337303) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(tert-butylcarbamoyl)phenyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(tert-butylcarbamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 90337303 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(tert-butylcarbamoyl)phenyl]carbamate |
| SMILES | CC(C)(C)NC(=O)c1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-26(2,3)28-24(29)17-12-14-18(15-13-17)27-25(30)31-16-23-21-10-6-4-8-19(21)20-9-5-7-11-22(20)23/h4-15,23H,16H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | PDBFPFPPMFUFMO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |